Dinuclear metal complexes of the bis(di-i-propylphosphino) methane ligand

by Anderson, Thomas Jefferson; Vicic, David A.